C13H5ClF4N4S — CID 133371012
4-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-2,3,5,6-tetrafluoropyridine (PubChem CID 133371012) has the molecular formula C13H5ClF4N4S and a molecular weight of 360.72 g/mol. Its IUPAC name is 4-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-2,3,5,6-tetrafluoropyridine.
| Compound Name | 4-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-2,3,5,6-tetrafluoropyridine |
|---|---|
| PubChem CID | 133371012 |
| Molecular Formula | C13H5ClF4N4S |
| Molecular Weight | 360.72 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 4-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-2,3,5,6-tetrafluoropyridine |
| SMILES | Fc1nc(F)c(F)c(Sc2n[nH]c(-c3ccc(Cl)cc3)n2)c1F |
| InChI | InChI=1S/C13H5ClF4N4S/c14-6-3-1-5(2-4-6)12-20-13(22-21-12)23-9-7(15)10(17)19-11(18)8(9)16/h1-4H,(H,20,21,22) |
| InChIKey | DNADWAHFTNZMGL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.72 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|