C13H14ClN3OS — CID 47152499
5-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]pentan-2-one (PubChem CID 47152499) has the molecular formula C13H14ClN3OS and a molecular weight of 295.80 g/mol. Its IUPAC name is 5-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]pentan-2-one.
| Compound Name | 5-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]pentan-2-one |
|---|---|
| PubChem CID | 47152499 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 5-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]pentan-2-one |
| SMILES | CC(=O)CCCSc1n[nH]c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C13H14ClN3OS/c1-9(18)3-2-8-19-13-15-12(16-17-13)10-4-6-11(14)7-5-10/h4-7H,2-3,8H2,1H3,(H,15,16,17) |
| InChIKey | FWYKMKRFFUTREA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|