C21H22ClN3OS — CID 2743443
1-(4-chlorophenyl)-2-[[5-(4-pentylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 2743443) has the molecular formula C21H22ClN3OS and a molecular weight of 399.95 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[[5-(4-pentylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-(4-chlorophenyl)-2-[[5-(4-pentylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 2743443 |
| Molecular Formula | C21H22ClN3OS |
| Molecular Weight | 399.95 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[[5-(4-pentylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | CCCCCc1ccc(-c2nc(SCC(=O)c3ccc(Cl)cc3)n[nH]2)cc1 |
| InChI | InChI=1S/C21H22ClN3OS/c1-2-3-4-5-15-6-8-17(9-7-15)20-23-21(25-24-20)27-14-19(26)16-10-12-18(22)13-11-16/h6-13H,2-5,14H2,1H3,(H,23,24,25) |
| InChIKey | ALNKTGWZCVNRRY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.95 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|