C16H19N3S — CID 2743439
5-(4-pentylphenyl)-3-prop-2-ynylsulfanyl-1H-1,2,4-triazole (PubChem CID 2743439) has the molecular formula C16H19N3S and a molecular weight of 285.42 g/mol. Its IUPAC name is 5-(4-pentylphenyl)-3-prop-2-ynylsulfanyl-1H-1,2,4-triazole.
| Compound Name | 5-(4-pentylphenyl)-3-prop-2-ynylsulfanyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 2743439 |
| Molecular Formula | C16H19N3S |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 5-(4-pentylphenyl)-3-prop-2-ynylsulfanyl-1H-1,2,4-triazole |
| SMILES | C#CCSc1n[nH]c(-c2ccc(CCCCC)cc2)n1 |
| InChI | InChI=1S/C16H19N3S/c1-3-5-6-7-13-8-10-14(11-9-13)15-17-16(19-18-15)20-12-4-2/h2,8-11H,3,5-7,12H2,1H3,(H,17,18,19) |
| InChIKey | UPTHFIBKSUFYKI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|