C22H24N4O2S — CID 7908419
N-[4-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]phenyl]hexanamide (PubChem CID 7908419) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is N-[4-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]phenyl]hexanamide.
| Compound Name | N-[4-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 7908419 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[4-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(C(=O)CSc2n[nH]c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H24N4O2S/c1-2-3-5-10-20(28)23-18-13-11-16(12-14-18)19(27)15-29-22-24-21(25-26-22)17-8-6-4-7-9-17/h4,6-9,11-14H,2-3,5,10,15H2,1H3,(H,23,28)(H,24,25,26) |
| InChIKey | SHEMGYLCEUOHRO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|