C18H15N3O4S — CID 4887327
3-[5-(4-acetylphenyl)furan-2-yl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid (PubChem CID 4887327) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is 3-[5-(4-acetylphenyl)furan-2-yl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid.
| Compound Name | 3-[5-(4-acetylphenyl)furan-2-yl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 4887327 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 3-[5-(4-acetylphenyl)furan-2-yl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid |
| SMILES | CC(=O)c1ccc(-c2ccc(C=C(Sc3n[nH]c(C)n3)C(=O)O)o2)cc1 |
| InChI | InChI=1S/C18H15N3O4S/c1-10(22)12-3-5-13(6-4-12)15-8-7-14(25-15)9-16(17(23)24)26-18-19-11(2)20-21-18/h3-9H,1-2H3,(H,23,24)(H,19,20,21) |
| InChIKey | ZJTDNRKDJAKASB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|