C15H15ClINO — CID 114257777
2-chloro-1-[1-(3-iodo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 114257777) has the molecular formula C15H15ClINO and a molecular weight of 387.65 g/mol. Its IUPAC name is 2-chloro-1-[1-(3-iodo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-chloro-1-[1-(3-iodo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 114257777 |
| Molecular Formula | C15H15ClINO |
| Molecular Weight | 387.65 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | 2-chloro-1-[1-(3-iodo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)CCl)c2C)cc1I |
| InChI | InChI=1S/C15H15ClINO/c1-9-4-5-12(7-14(9)17)18-10(2)6-13(11(18)3)15(19)8-16/h4-7H,8H2,1-3H3 |
| InChIKey | NFSBKKBDUSQECX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.65 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|