C10H10ClIO — CID 171002229
2-chloro-1-(5-iodo-2,4-dimethylphenyl)ethanone (PubChem CID 171002229) has the molecular formula C10H10ClIO and a molecular weight of 308.55 g/mol. Its IUPAC name is 2-chloro-1-(5-iodo-2,4-dimethylphenyl)ethanone.
| Compound Name | 2-chloro-1-(5-iodo-2,4-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 171002229 |
| Molecular Formula | C10H10ClIO |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 307.95 |
| IUPAC Name | 2-chloro-1-(5-iodo-2,4-dimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(C(=O)CCl)cc1I |
| InChI | InChI=1S/C10H10ClIO/c1-6-3-7(2)9(12)4-8(6)10(13)5-11/h3-4H,5H2,1-2H3 |
| InChIKey | GHBBEZJVDNUKSB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|