C24H32N2O5 — CID 45042535
2-(azepan-1-yl)-1-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]ethanone;oxalic acid (PubChem CID 45042535) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-(azepan-1-yl)-1-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]ethanone;oxalic acid.
| Compound Name | 2-(azepan-1-yl)-1-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]ethanone;oxalic acid |
|---|---|
| PubChem CID | 45042535 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 2-(azepan-1-yl)-1-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]ethanone;oxalic acid |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)CN3CCCCCC3)c2C)cc1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H30N2O.C2H2O4/c1-16-9-10-20(13-17(16)2)24-18(3)14-21(19(24)4)22(25)15-23-11-7-5-6-8-12-23;3-1(4)2(5)6/h9-10,13-14H,5-8,11-12,15H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | NWHRBOQWSFBIRZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 99.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|