C23H32FN3O — CID 56569998
1-[1-(3-fluoro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(propan-2-ylamino)piperidin-1-yl]ethanone (PubChem CID 56569998) has the molecular formula C23H32FN3O and a molecular weight of 385.53 g/mol. Its IUPAC name is 1-[1-(3-fluoro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(propan-2-ylamino)piperidin-1-yl]ethanone.
| Compound Name | 1-[1-(3-fluoro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(propan-2-ylamino)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 56569998 |
| Molecular Formula | C23H32FN3O |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 1-[1-(3-fluoro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(propan-2-ylamino)piperidin-1-yl]ethanone |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)CN3CCC(NC(C)C)CC3)c2C)cc1F |
| InChI | InChI=1S/C23H32FN3O/c1-15(2)25-19-8-10-26(11-9-19)14-23(28)21-12-17(4)27(18(21)5)20-7-6-16(3)22(24)13-20/h6-7,12-13,15,19,25H,8-11,14H2,1-5H3 |
| InChIKey | WAZHDZVSBBOZJB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|