C14H13BrClNO — CID 2125349
1-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-chloroethanone (PubChem CID 2125349) has the molecular formula C14H13BrClNO and a molecular weight of 326.62 g/mol. Its IUPAC name is 1-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-chloroethanone.
| Compound Name | 1-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-chloroethanone |
|---|---|
| PubChem CID | 2125349 |
| Molecular Formula | C14H13BrClNO |
| Molecular Weight | 326.62 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 1-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-chloroethanone |
| SMILES | Cc1cc(C(=O)CCl)c(C)n1-c1cccc(Br)c1 |
| InChI | InChI=1S/C14H13BrClNO/c1-9-6-13(14(18)8-16)10(2)17(9)12-5-3-4-11(15)7-12/h3-7H,8H2,1-2H3 |
| InChIKey | XRZKRJMMLOKWAT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|