C17H16IN3OS — CID 3251261
5-[[1-(3-iodo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 3251261) has the molecular formula C17H16IN3OS and a molecular weight of 437.31 g/mol. Its IUPAC name is 5-[[1-(3-iodo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[[1-(3-iodo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 3251261 |
| Molecular Formula | C17H16IN3OS |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | 5-[[1-(3-iodo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1ccc(-n2c(C)cc(C=C3NC(=S)NC3=O)c2C)cc1I |
| InChI | InChI=1S/C17H16IN3OS/c1-9-4-5-13(8-14(9)18)21-10(2)6-12(11(21)3)7-15-16(22)20-17(23)19-15/h4-8H,1-3H3,(H2,19,20,22,23) |
| InChIKey | QAOXWRWUOBVWIV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|