C18H18ClN3O2S — CID 21209192
(5E)-5-[[1-(3-chloro-4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 21209192) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is (5E)-5-[[1-(3-chloro-4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[1-(3-chloro-4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 21209192 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | (5E)-5-[[1-(3-chloro-4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(-n2c(C)cc(/C=C3/NC(=S)NC3=O)c2C)cc1Cl |
| InChI | InChI=1S/C18H18ClN3O2S/c1-4-24-16-6-5-13(9-14(16)19)22-10(2)7-12(11(22)3)8-15-17(23)21-18(25)20-15/h5-9H,4H2,1-3H3,(H2,20,21,23,25)/b15-8+ |
| InChIKey | FSCHHMMHVWTONI-OVCLIPMQSA-N |
| XLogP | 3.49 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|