C23H20BrNO3S — CID 126614932
phenyl 2-acetylsulfanyl-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate (PubChem CID 126614932) has the molecular formula C23H20BrNO3S and a molecular weight of 470.39 g/mol. Its IUPAC name is phenyl 2-acetylsulfanyl-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate.
| Compound Name | phenyl 2-acetylsulfanyl-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 126614932 |
| Molecular Formula | C23H20BrNO3S |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | phenyl 2-acetylsulfanyl-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
| SMILES | CC(=O)SC(=Cc1cc(C)n(-c2ccc(Br)cc2)c1C)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C23H20BrNO3S/c1-15-13-18(16(2)25(15)20-11-9-19(24)10-12-20)14-22(29-17(3)26)23(27)28-21-7-5-4-6-8-21/h4-14H,1-3H3 |
| InChIKey | HAUODRXWWPMVBR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|