C25H25NO4 — CID 126614947
phenyl 2-acetyloxy-3-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate (PubChem CID 126614947) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is phenyl 2-acetyloxy-3-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate.
| Compound Name | phenyl 2-acetyloxy-3-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 126614947 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | phenyl 2-acetyloxy-3-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
| SMILES | CCc1ccc(-n2c(C)cc(C=C(OC(C)=O)C(=O)Oc3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C25H25NO4/c1-5-20-11-13-22(14-12-20)26-17(2)15-21(18(26)3)16-24(29-19(4)27)25(28)30-23-9-7-6-8-10-23/h6-16H,5H2,1-4H3 |
| InChIKey | XEWQMPNTNDSXLG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|