C24H22N2O3S2 — CID 126614911
phenyl 2-acetylsulfanyl-3-[1-(3-cyano-4,5-dimethylthiophen-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate (PubChem CID 126614911) has the molecular formula C24H22N2O3S2 and a molecular weight of 450.59 g/mol. Its IUPAC name is phenyl 2-acetylsulfanyl-3-[1-(3-cyano-4,5-dimethylthiophen-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate.
| Compound Name | phenyl 2-acetylsulfanyl-3-[1-(3-cyano-4,5-dimethylthiophen-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 126614911 |
| Molecular Formula | C24H22N2O3S2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | phenyl 2-acetylsulfanyl-3-[1-(3-cyano-4,5-dimethylthiophen-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
| SMILES | CC(=O)SC(=Cc1cc(C)n(-c2sc(C)c(C)c2C#N)c1C)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C24H22N2O3S2/c1-14-11-19(16(3)26(14)23-21(13-25)15(2)17(4)30-23)12-22(31-18(5)27)24(28)29-20-9-7-6-8-10-20/h6-12H,1-5H3 |
| InChIKey | CONDIKADJIMEFC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|