C23H22N4O2S — CID 3719560
2-[3-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carbonitrile (PubChem CID 3719560) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is 2-[3-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carbonitrile.
| Compound Name | 2-[3-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carbonitrile |
|---|---|
| PubChem CID | 3719560 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-[3-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carbonitrile |
| SMILES | Cc1sc(-n2c(C)cc(C=NN3C(=O)C4C5C=CC(C5)C4C3=O)c2C)c(C#N)c1C |
| InChI | InChI=1S/C23H22N4O2S/c1-11-7-17(13(3)26(11)23-18(9-24)12(2)14(4)30-23)10-25-27-21(28)19-15-5-6-16(8-15)20(19)22(27)29/h5-7,10,15-16,19-20H,8H2,1-4H3 |
| InChIKey | IUZWVFINMYIESY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|