C25H24N4O3 — CID 21379803
2-[3-[(E)-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylfuran-3-carbonitrile (PubChem CID 21379803) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-[3-[(E)-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylfuran-3-carbonitrile.
| Compound Name | 2-[3-[(E)-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 21379803 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-[3-[(E)-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylfuran-3-carbonitrile |
| SMILES | Cc1oc(-n2c(C)cc(/C=N/N3C(=O)C4C5C=CC(C6CC56)C4C3=O)c2C)c(C#N)c1C |
| InChI | InChI=1S/C25H24N4O3/c1-11-7-15(13(3)28(11)25-20(9-26)12(2)14(4)32-25)10-27-29-23(30)21-16-5-6-17(19-8-18(16)19)22(21)24(29)31/h5-7,10,16-19,21-22H,8H2,1-4H3/b27-10+ |
| InChIKey | ZIRNAOODBVKKJS-YPXUMCKCSA-N |
| XLogP | 3.56 |
| TPSA | 91.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|