C21H19N3O2S — CID 1277785
4-[[1-(3-cyano-4,5-dimethylthiophen-2-yl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzoic acid (PubChem CID 1277785) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is 4-[[1-(3-cyano-4,5-dimethylthiophen-2-yl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzoic acid.
| Compound Name | 4-[[1-(3-cyano-4,5-dimethylthiophen-2-yl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 1277785 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 4-[[1-(3-cyano-4,5-dimethylthiophen-2-yl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzoic acid |
| SMILES | Cc1sc(-n2c(C)cc(/C=N/c3ccc(C(=O)O)cc3)c2C)c(C#N)c1C |
| InChI | InChI=1S/C21H19N3O2S/c1-12-9-17(11-23-18-7-5-16(6-8-18)21(25)26)14(3)24(12)20-19(10-22)13(2)15(4)27-20/h5-9,11H,1-4H3,(H,25,26)/b23-11+ |
| InChIKey | VURWGBKUWLCIJP-FOKLQQMPSA-N |
| XLogP | 5.09 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|