C22H18FN5OS — CID 4234264
4-cyano-N-[[1-(3-cyano-4,5-dimethylthiophen-2-yl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-fluorobenzamide (PubChem CID 4234264) has the molecular formula C22H18FN5OS and a molecular weight of 419.49 g/mol. Its IUPAC name is 4-cyano-N-[[1-(3-cyano-4,5-dimethylthiophen-2-yl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-fluorobenzamide.
| Compound Name | 4-cyano-N-[[1-(3-cyano-4,5-dimethylthiophen-2-yl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4234264 |
| Molecular Formula | C22H18FN5OS |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 4-cyano-N-[[1-(3-cyano-4,5-dimethylthiophen-2-yl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-fluorobenzamide |
| SMILES | Cc1sc(-n2c(C)cc(C=NNC(=O)c3ccc(C#N)cc3F)c2C)c(C#N)c1C |
| InChI | InChI=1S/C22H18FN5OS/c1-12-7-17(14(3)28(12)22-19(10-25)13(2)15(4)30-22)11-26-27-21(29)18-6-5-16(9-24)8-20(18)23/h5-8,11H,1-4H3,(H,27,29) |
| InChIKey | KMEYZWOSFVEWEL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|