C24H23FN4O3S — CID 4681573
ethyl 2-[3-[[(4-cyano-2-fluorobenzoyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 4681573) has the molecular formula C24H23FN4O3S and a molecular weight of 466.54 g/mol. Its IUPAC name is ethyl 2-[3-[[(4-cyano-2-fluorobenzoyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-[[(4-cyano-2-fluorobenzoyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4681573 |
| Molecular Formula | C24H23FN4O3S |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | ethyl 2-[3-[[(4-cyano-2-fluorobenzoyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-n2c(C)cc(C=NNC(=O)c3ccc(C#N)cc3F)c2C)sc(C)c1C |
| InChI | InChI=1S/C24H23FN4O3S/c1-6-32-24(31)21-14(3)16(5)33-23(21)29-13(2)9-18(15(29)4)12-27-28-22(30)19-8-7-17(11-26)10-20(19)25/h7-10,12H,6H2,1-5H3,(H,28,30) |
| InChIKey | YSDDMQQIQFVITJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|