C25H24ClN3O4S — CID 126029876
ethyl 2-[3-[(E)-[(5-chloro-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 126029876) has the molecular formula C25H24ClN3O4S and a molecular weight of 498.00 g/mol. Its IUPAC name is ethyl 2-[3-[(E)-[(5-chloro-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-[(E)-[(5-chloro-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 126029876 |
| Molecular Formula | C25H24ClN3O4S |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | ethyl 2-[3-[(E)-[(5-chloro-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-n2c(C)cc(/C=N/NC(=O)c3cc4cc(Cl)ccc4o3)c2C)sc(C)c1C |
| InChI | InChI=1S/C25H24ClN3O4S/c1-6-32-25(31)22-14(3)16(5)34-24(22)29-13(2)9-18(15(29)4)12-27-28-23(30)21-11-17-10-19(26)7-8-20(17)33-21/h7-12H,6H2,1-5H3,(H,28,30)/b27-12+ |
| InChIKey | WXMDIFTYTWSVAI-KKMKTNMSSA-N |
| XLogP | 6.11 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|