C23H19ClN4O3 — CID 126226008
N-[(Z)-(1-benzamido-2,5-dimethylpyrrol-3-yl)methylideneamino]-5-chloro-1-benzofuran-2-carboxamide (PubChem CID 126226008) has the molecular formula C23H19ClN4O3 and a molecular weight of 434.88 g/mol. Its IUPAC name is N-[(Z)-(1-benzamido-2,5-dimethylpyrrol-3-yl)methylideneamino]-5-chloro-1-benzofuran-2-carboxamide.
| Compound Name | N-[(Z)-(1-benzamido-2,5-dimethylpyrrol-3-yl)methylideneamino]-5-chloro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126226008 |
| Molecular Formula | C23H19ClN4O3 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | N-[(Z)-(1-benzamido-2,5-dimethylpyrrol-3-yl)methylideneamino]-5-chloro-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2cc3cc(Cl)ccc3o2)c(C)n1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19ClN4O3/c1-14-10-18(15(2)28(14)27-22(29)16-6-4-3-5-7-16)13-25-26-23(30)21-12-17-11-19(24)8-9-20(17)31-21/h3-13H,1-2H3,(H,26,30)(H,27,29)/b25-13- |
| InChIKey | VFNPHDBALDLZGO-MXAYSNPKSA-N |
| XLogP | 4.65 |
| TPSA | 88.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|