C20H17BrClN3O — CID 126216983
N-[3-[(4-bromo-3-chlorophenyl)iminomethyl]-2,5-dimethylpyrrol-1-yl]benzamide (PubChem CID 126216983) has the molecular formula C20H17BrClN3O and a molecular weight of 430.73 g/mol. Its IUPAC name is N-[3-[(4-bromo-3-chlorophenyl)iminomethyl]-2,5-dimethylpyrrol-1-yl]benzamide.
| Compound Name | N-[3-[(4-bromo-3-chlorophenyl)iminomethyl]-2,5-dimethylpyrrol-1-yl]benzamide |
|---|---|
| PubChem CID | 126216983 |
| Molecular Formula | C20H17BrClN3O |
| Molecular Weight | 430.73 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | N-[3-[(4-bromo-3-chlorophenyl)iminomethyl]-2,5-dimethylpyrrol-1-yl]benzamide |
| SMILES | Cc1cc(/C=N/c2ccc(Br)c(Cl)c2)c(C)n1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H17BrClN3O/c1-13-10-16(12-23-17-8-9-18(21)19(22)11-17)14(2)25(13)24-20(26)15-6-4-3-5-7-15/h3-12H,1-2H3,(H,24,26)/b23-12+ |
| InChIKey | LBKFTFIJDLDOII-FSJBWODESA-N |
| XLogP | 5.66 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.73 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|