C24H21ClN4O2 — CID 126215785
N-[3-[(Z)-3-(5-chloro-2-methylanilino)-2-cyano-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]benzamide (PubChem CID 126215785) has the molecular formula C24H21ClN4O2 and a molecular weight of 432.91 g/mol. Its IUPAC name is N-[3-[(Z)-3-(5-chloro-2-methylanilino)-2-cyano-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]benzamide.
| Compound Name | N-[3-[(Z)-3-(5-chloro-2-methylanilino)-2-cyano-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]benzamide |
|---|---|
| PubChem CID | 126215785 |
| Molecular Formula | C24H21ClN4O2 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[3-[(Z)-3-(5-chloro-2-methylanilino)-2-cyano-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]benzamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)/C(C#N)=C\c1cc(C)n(NC(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C24H21ClN4O2/c1-15-9-10-21(25)13-22(15)27-23(30)20(14-26)12-19-11-16(2)29(17(19)3)28-24(31)18-7-5-4-6-8-18/h4-13H,1-3H3,(H,27,30)(H,28,31)/b20-12- |
| InChIKey | HEGCYUANRORHSG-NDENLUEZSA-N |
| XLogP | 5.00 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|