C27H24ClN5O2 — CID 4318087
4-chloro-N-[3-[2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]benzamide (PubChem CID 4318087) has the molecular formula C27H24ClN5O2 and a molecular weight of 485.98 g/mol. Its IUPAC name is 4-chloro-N-[3-[2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]benzamide.
| Compound Name | 4-chloro-N-[3-[2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]benzamide |
|---|---|
| PubChem CID | 4318087 |
| Molecular Formula | C27H24ClN5O2 |
| Molecular Weight | 485.98 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 4-chloro-N-[3-[2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]benzamide |
| SMILES | Cc1cc(C=C(C#N)C(=O)NCCc2c[nH]c3ccccc23)c(C)n1NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H24ClN5O2/c1-17-13-21(18(2)33(17)32-27(35)19-7-9-23(28)10-8-19)14-22(15-29)26(34)30-12-11-20-16-31-25-6-4-3-5-24(20)25/h3-10,13-14,16,31H,11-12H2,1-2H3,(H,30,34)(H,32,35) |
| InChIKey | ZGIIADRLQFUDPM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 102.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.98 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|