C27H29ClN4O — CID 99886625
(Z)-3-[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]-2-cyano-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide (PubChem CID 99886625) has the molecular formula C27H29ClN4O and a molecular weight of 461.01 g/mol. Its IUPAC name is (Z)-3-[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]-2-cyano-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide.
| Compound Name | (Z)-3-[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]-2-cyano-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 99886625 |
| Molecular Formula | C27H29ClN4O |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | (Z)-3-[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]-2-cyano-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
| SMILES | C[C@@H]1CC(C)(C)N(C)c2cc(Cl)c(/C=C(/C#N)C(=O)NCCc3c[nH]c4ccccc34)cc21 |
| InChI | InChI=1S/C27H29ClN4O/c1-17-14-27(2,3)32(4)25-13-23(28)19(12-22(17)25)11-20(15-29)26(33)30-10-9-18-16-31-24-8-6-5-7-21(18)24/h5-8,11-13,16-17,31H,9-10,14H2,1-4H3,(H,30,33)/b20-11-/t17-/m1/s1 |
| InChIKey | JYYDDATXQXXDOD-LELXDKESSA-N |
| XLogP | 5.81 |
| TPSA | 71.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|