C28H26N4O3 — CID 21215975
4-[3-[(E)-2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoic acid (PubChem CID 21215975) has the molecular formula C28H26N4O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is 4-[3-[(E)-2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoic acid.
| Compound Name | 4-[3-[(E)-2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 21215975 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 4-[3-[(E)-2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-n1c(C)cc(/C=C(\C#N)C(=O)NCCc2c[nH]c3ccccc23)c1C |
| InChI | InChI=1S/C28H26N4O3/c1-17-12-20(28(34)35)8-9-26(17)32-18(2)13-22(19(32)3)14-23(15-29)27(33)30-11-10-21-16-31-25-7-5-4-6-24(21)25/h4-9,12-14,16,31H,10-11H2,1-3H3,(H,30,33)(H,34,35)/b23-14+ |
| InChIKey | VEYONJHNNYJWDW-OEAKJJBVSA-N |
| XLogP | 4.85 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|