C29H25N3O5 — CID 21214485
3-[[2-[(E)-2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 21214485) has the molecular formula C29H25N3O5 and a molecular weight of 495.54 g/mol. Its IUPAC name is 3-[[2-[(E)-2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-[(E)-2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 21214485 |
| Molecular Formula | C29H25N3O5 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 3-[[2-[(E)-2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cccc(/C=C(\C#N)C(=O)NCCc2c[nH]c3ccccc23)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C29H25N3O5/c1-36-26-11-5-7-20(27(26)37-18-19-6-4-8-21(14-19)29(34)35)15-23(16-30)28(33)31-13-12-22-17-32-25-10-3-2-9-24(22)25/h2-11,14-15,17,32H,12-13,18H2,1H3,(H,31,33)(H,34,35)/b23-15+ |
| InChIKey | FILUUPQVYKCFPX-HZHRSRAPSA-N |
| XLogP | 4.72 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|