C24H18Cl2N4O4 — CID 126217960
N-[3-[(E)-[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzamide (PubChem CID 126217960) has the molecular formula C24H18Cl2N4O4 and a molecular weight of 497.34 g/mol. Its IUPAC name is N-[3-[(E)-[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzamide.
| Compound Name | N-[3-[(E)-[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzamide |
|---|---|
| PubChem CID | 126217960 |
| Molecular Formula | C24H18Cl2N4O4 |
| Molecular Weight | 497.34 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | N-[3-[(E)-[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzamide |
| SMILES | Cc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(Cl)cc3Cl)C2=O)c(C)n1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H18Cl2N4O4/c1-13-10-16(14(2)30(13)28-21(31)15-6-4-3-5-7-15)11-18-22(32)27-24(34)29(23(18)33)20-9-8-17(25)12-19(20)26/h3-12H,1-2H3,(H,28,31)(H,27,32,34)/b18-11+ |
| InChIKey | OLHOUFMRCBSYNM-WOJGMQOQSA-N |
| XLogP | 4.46 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|