C24H20Cl2N4O3 — CID 126219073
N-[3-[(Z)-[1-[(2,4-dichlorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzamide (PubChem CID 126219073) has the molecular formula C24H20Cl2N4O3 and a molecular weight of 483.36 g/mol. Its IUPAC name is N-[3-[(Z)-[1-[(2,4-dichlorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzamide.
| Compound Name | N-[3-[(Z)-[1-[(2,4-dichlorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzamide |
|---|---|
| PubChem CID | 126219073 |
| Molecular Formula | C24H20Cl2N4O3 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | N-[3-[(Z)-[1-[(2,4-dichlorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzamide |
| SMILES | Cc1cc(/C=C2\NC(=O)N(Cc3ccc(Cl)cc3Cl)C2=O)c(C)n1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H20Cl2N4O3/c1-14-10-18(15(2)30(14)28-22(31)16-6-4-3-5-7-16)11-21-23(32)29(24(33)27-21)13-17-8-9-19(25)12-20(17)26/h3-12H,13H2,1-2H3,(H,27,33)(H,28,31)/b21-11- |
| InChIKey | RFHYUKGCFIITEC-NHDPSOOVSA-N |
| XLogP | 4.89 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|