C25H25N3O2 — CID 25250588
(5Z)-3-benzyl-5-[[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 25250588) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-[[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-3-benzyl-5-[[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 25250588 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (5Z)-3-benzyl-5-[[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | CCc1ccccc1-n1c(C)cc(/C=C2\NC(=O)N(Cc3ccccc3)C2=O)c1C |
| InChI | InChI=1S/C25H25N3O2/c1-4-20-12-8-9-13-23(20)28-17(2)14-21(18(28)3)15-22-24(29)27(25(30)26-22)16-19-10-6-5-7-11-19/h5-15H,4,16H2,1-3H3,(H,26,30)/b22-15- |
| InChIKey | MGMQIGVIZOQOOC-JCMHNJIXSA-N |
| XLogP | 4.75 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|