C23H22N4O4S — CID 1492504
4-[3-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzenesulfonamide (PubChem CID 1492504) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is 4-[3-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 1492504 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 4-[3-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzenesulfonamide |
| SMILES | Cc1cc(/C=C2/NC(=O)N(Cc3ccccc3)C2=O)c(C)n1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C23H22N4O4S/c1-15-12-18(16(2)27(15)19-8-10-20(11-9-19)32(24,30)31)13-21-22(28)26(23(29)25-21)14-17-6-4-3-5-7-17/h3-13H,14H2,1-2H3,(H,25,29)(H2,24,30,31)/b21-13+ |
| InChIKey | AVZGKJSUAGAJQW-FYJGNVAPSA-N |
| XLogP | 2.83 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|