C25H24ClN3O2 — CID 126230128
(5E)-5-[[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-[(3-methylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126230128) has the molecular formula C25H24ClN3O2 and a molecular weight of 433.94 g/mol. Its IUPAC name is (5E)-5-[[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-[(3-methylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-[(3-methylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126230128 |
| Molecular Formula | C25H24ClN3O2 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | (5E)-5-[[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-[(3-methylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1cccc(CN2C(=O)N/C(=C/c3cc(C)n(-c4cccc(Cl)c4C)c3C)C2=O)c1 |
| InChI | InChI=1S/C25H24ClN3O2/c1-15-7-5-8-19(11-15)14-28-24(30)22(27-25(28)31)13-20-12-16(2)29(18(20)4)23-10-6-9-21(26)17(23)3/h5-13H,14H2,1-4H3,(H,27,31)/b22-13+ |
| InChIKey | GRMWZCPTNDRZHJ-LPYMAVHISA-N |
| XLogP | 5.46 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|