C24H22Cl2FN3O2 — CID 50865627
(5E)-3-[(2,4-dichlorophenyl)methyl]-5-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]imidazolidine-2,4-dione (PubChem CID 50865627) has the molecular formula C24H22Cl2FN3O2 and a molecular weight of 474.36 g/mol. Its IUPAC name is (5E)-3-[(2,4-dichlorophenyl)methyl]-5-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2,4-dichlorophenyl)methyl]-5-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 50865627 |
| Molecular Formula | C24H22Cl2FN3O2 |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | (5E)-3-[(2,4-dichlorophenyl)methyl]-5-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]imidazolidine-2,4-dione |
| SMILES | CC1=CC(C)(C)N(C)c2cc(F)c(/C=C3/NC(=O)N(Cc4ccc(Cl)cc4Cl)C3=O)cc21 |
| InChI | InChI=1S/C24H22Cl2FN3O2/c1-13-11-24(2,3)29(4)21-10-19(27)15(7-17(13)21)8-20-22(31)30(23(32)28-20)12-14-5-6-16(25)9-18(14)26/h5-11H,12H2,1-4H3,(H,28,32)/b20-8+ |
| InChIKey | VRFMHTLXOYIDEO-DNTJNYDQSA-N |
| XLogP | 5.86 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|