C24H23F2N3O2 — CID 50865522
(5E)-3-[(2-fluorophenyl)methyl]-5-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]imidazolidine-2,4-dione (PubChem CID 50865522) has the molecular formula C24H23F2N3O2 and a molecular weight of 423.46 g/mol. Its IUPAC name is (5E)-3-[(2-fluorophenyl)methyl]-5-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2-fluorophenyl)methyl]-5-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 50865522 |
| Molecular Formula | C24H23F2N3O2 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (5E)-3-[(2-fluorophenyl)methyl]-5-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]imidazolidine-2,4-dione |
| SMILES | CC1=CC(C)(C)N(C)c2cc(F)c(/C=C3/NC(=O)N(Cc4ccccc4F)C3=O)cc21 |
| InChI | InChI=1S/C24H23F2N3O2/c1-14-12-24(2,3)28(4)21-11-19(26)16(9-17(14)21)10-20-22(30)29(23(31)27-20)13-15-7-5-6-8-18(15)25/h5-12H,13H2,1-4H3,(H,27,31)/b20-10+ |
| InChIKey | VGPITONTORKPTA-KEBDBYFISA-N |
| XLogP | 4.69 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|