C27H29Cl2N3O2 — CID 50869029
(5E)-3-[(3,4-dichlorophenyl)methyl]-5-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylidene]imidazolidine-2,4-dione (PubChem CID 50869029) has the molecular formula C27H29Cl2N3O2 and a molecular weight of 498.45 g/mol. Its IUPAC name is (5E)-3-[(3,4-dichlorophenyl)methyl]-5-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-[(3,4-dichlorophenyl)methyl]-5-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 50869029 |
| Molecular Formula | C27H29Cl2N3O2 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | (5E)-3-[(3,4-dichlorophenyl)methyl]-5-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylidene]imidazolidine-2,4-dione |
| SMILES | CCCN1c2cc(C)c(/C=C3/NC(=O)N(Cc4ccc(Cl)c(Cl)c4)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C27H29Cl2N3O2/c1-6-9-32-24-10-16(2)19(12-20(24)17(3)14-27(32,4)5)13-23-25(33)31(26(34)30-23)15-18-7-8-21(28)22(29)11-18/h7-8,10-14H,6,9,15H2,1-5H3,(H,30,34)/b23-13+ |
| InChIKey | ZDYLYIJHQZENOS-YDZHTSKRSA-N |
| XLogP | 6.81 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|