C20H22ClN3O3 — CID 50868900
5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 50868900) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is 5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 50868900 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCN1c2cc(Cl)c(C=C3C(=O)NC(=O)NC3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C20H22ClN3O3/c1-5-6-24-16-9-15(21)12(7-13(16)11(2)10-20(24,3)4)8-14-17(25)22-19(27)23-18(14)26/h7-10H,5-6H2,1-4H3,(H2,22,23,25,26,27) |
| InChIKey | UZLVOZBJZBFCTI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|