C18H20ClN3O2 — CID 50866877
(5Z)-5-[(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]imidazolidine-2,4-dione (PubChem CID 50866877) has the molecular formula C18H20ClN3O2 and a molecular weight of 345.83 g/mol. Its IUPAC name is (5Z)-5-[(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 50866877 |
| Molecular Formula | C18H20ClN3O2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (5Z)-5-[(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]imidazolidine-2,4-dione |
| SMILES | CCN1c2cc(Cl)c(/C=C3\NC(=O)NC3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C18H20ClN3O2/c1-5-22-15-8-13(19)11(7-14-16(23)21-17(24)20-14)6-12(15)10(2)9-18(22,3)4/h6-9H,5H2,1-4H3,(H2,20,21,23,24)/b14-7- |
| InChIKey | PVXYLCFTHIUICX-AUWJEWJLSA-N |
| XLogP | 3.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|