C18H21N3O2 — CID 99887422
(5E)-5-[(1,2,2,4,7-pentamethylquinolin-6-yl)methylidene]imidazolidine-2,4-dione (PubChem CID 99887422) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is (5E)-5-[(1,2,2,4,7-pentamethylquinolin-6-yl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(1,2,2,4,7-pentamethylquinolin-6-yl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 99887422 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (5E)-5-[(1,2,2,4,7-pentamethylquinolin-6-yl)methylidene]imidazolidine-2,4-dione |
| SMILES | CC1=CC(C)(C)N(C)c2cc(C)c(/C=C3/NC(=O)NC3=O)cc21 |
| InChI | InChI=1S/C18H21N3O2/c1-10-6-15-13(11(2)9-18(3,4)21(15)5)7-12(10)8-14-16(22)20-17(23)19-14/h6-9H,1-5H3,(H2,19,20,22,23)/b14-8+ |
| InChIKey | FCEDIIBGGZADBC-RIYZIHGNSA-N |
| XLogP | 2.81 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|