C26H25BrClN3O2S — CID 50869121
(5Z)-1-(3-bromophenyl)-5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 50869121) has the molecular formula C26H25BrClN3O2S and a molecular weight of 558.93 g/mol. Its IUPAC name is (5Z)-1-(3-bromophenyl)-5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5Z)-1-(3-bromophenyl)-5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 50869121 |
| Molecular Formula | C26H25BrClN3O2S |
| Molecular Weight | 558.93 g/mol |
| Exact Mass | 557.05 |
| IUPAC Name | (5Z)-1-(3-bromophenyl)-5-[(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCCN1c2cc(Cl)c(/C=C3/C(=O)NC(=S)N(c4cccc(Br)c4)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C26H25BrClN3O2S/c1-5-9-30-22-13-21(28)16(10-19(22)15(2)14-26(30,3)4)11-20-23(32)29-25(34)31(24(20)33)18-8-6-7-17(27)12-18/h6-8,10-14H,5,9H2,1-4H3,(H,29,32,34)/b20-11- |
| InChIKey | MTSGNSCCDFDTAX-JAIQZWGSSA-N |
| XLogP | 6.35 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.93 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|