C28H30BrN3O3 — CID 50868662
(5Z)-1-(4-bromo-2-methylphenyl)-5-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 50868662) has the molecular formula C28H30BrN3O3 and a molecular weight of 536.47 g/mol. Its IUPAC name is (5Z)-1-(4-bromo-2-methylphenyl)-5-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-(4-bromo-2-methylphenyl)-5-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 50868662 |
| Molecular Formula | C28H30BrN3O3 |
| Molecular Weight | 536.47 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | (5Z)-1-(4-bromo-2-methylphenyl)-5-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCN1c2cc(C)c(/C=C3/C(=O)NC(=O)N(c4ccc(Br)cc4C)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C28H30BrN3O3/c1-7-10-31-24-12-16(2)19(13-21(24)18(4)15-28(31,5)6)14-22-25(33)30-27(35)32(26(22)34)23-9-8-20(29)11-17(23)3/h8-9,11-15H,7,10H2,1-6H3,(H,30,33,35)/b22-14- |
| InChIKey | SKMGAYOUDXWYCS-HMAPJEAMSA-N |
| XLogP | 6.14 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.47 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|