C28H31N3O3 — CID 50866740
(5Z)-1-(3,5-dimethylphenyl)-5-[(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 50866740) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is (5Z)-1-(3,5-dimethylphenyl)-5-[(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-(3,5-dimethylphenyl)-5-[(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 50866740 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | (5Z)-1-(3,5-dimethylphenyl)-5-[(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1c2cc(C)c(/C=C3/C(=O)NC(=O)N(c4cc(C)cc(C)c4)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C28H31N3O3/c1-8-30-24-12-18(4)20(13-22(24)19(5)15-28(30,6)7)14-23-25(32)29-27(34)31(26(23)33)21-10-16(2)9-17(3)11-21/h9-15H,8H2,1-7H3,(H,29,32,34)/b23-14- |
| InChIKey | UILFYVOMCZHBLA-UCQKPKSFSA-N |
| XLogP | 5.30 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|