C27H27Cl2N3O4 — CID 50869961
(5Z)-1-(2,4-dichlorophenyl)-5-[(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 50869961) has the molecular formula C27H27Cl2N3O4 and a molecular weight of 528.44 g/mol. Its IUPAC name is (5Z)-1-(2,4-dichlorophenyl)-5-[(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-(2,4-dichlorophenyl)-5-[(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 50869961 |
| Molecular Formula | C27H27Cl2N3O4 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | (5Z)-1-(2,4-dichlorophenyl)-5-[(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCN1c2cc(OC)c(/C=C3/C(=O)NC(=O)N(c4ccc(Cl)cc4Cl)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C27H27Cl2N3O4/c1-6-9-31-22-13-23(36-5)16(10-18(22)15(2)14-27(31,3)4)11-19-24(33)30-26(35)32(25(19)34)21-8-7-17(28)12-20(21)29/h7-8,10-14H,6,9H2,1-5H3,(H,30,33,35)/b19-11- |
| InChIKey | STTZOQQTWOZACL-ODLFYWEKSA-N |
| XLogP | 6.08 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|