C21H16Cl2N2O7 — CID 126226874
(2S)-2-[2-[(E)-[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]propanoic acid (PubChem CID 126226874) has the molecular formula C21H16Cl2N2O7 and a molecular weight of 479.27 g/mol. Its IUPAC name is (2S)-2-[2-[(E)-[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[2-[(E)-[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126226874 |
| Molecular Formula | C21H16Cl2N2O7 |
| Molecular Weight | 479.27 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | (2S)-2-[2-[(E)-[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]propanoic acid |
| SMILES | COc1cccc(/C=C2\C(=O)NC(=O)N(c3ccc(Cl)cc3Cl)C2=O)c1O[C@@H](C)C(=O)O |
| InChI | InChI=1S/C21H16Cl2N2O7/c1-10(20(28)29)32-17-11(4-3-5-16(17)31-2)8-13-18(26)24-21(30)25(19(13)27)15-7-6-12(22)9-14(15)23/h3-10H,1-2H3,(H,28,29)(H,24,26,30)/b13-8+/t10-/m0/s1 |
| InChIKey | DDVSTOAXKNHJPC-XNFYSYIQSA-N |
| XLogP | 3.52 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|