C22H20N2O7 — CID 126250611
(2R)-2-[2-methoxy-6-[(E)-[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]propanoic acid (PubChem CID 126250611) has the molecular formula C22H20N2O7 and a molecular weight of 424.41 g/mol. Its IUPAC name is (2R)-2-[2-methoxy-6-[(E)-[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]propanoic acid.
| Compound Name | (2R)-2-[2-methoxy-6-[(E)-[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126250611 |
| Molecular Formula | C22H20N2O7 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (2R)-2-[2-methoxy-6-[(E)-[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]propanoic acid |
| SMILES | COc1cccc(/C=C2\C(=O)NC(=O)N(c3ccccc3C)C2=O)c1O[C@H](C)C(=O)O |
| InChI | InChI=1S/C22H20N2O7/c1-12-7-4-5-9-16(12)24-20(26)15(19(25)23-22(24)29)11-14-8-6-10-17(30-3)18(14)31-13(2)21(27)28/h4-11,13H,1-3H3,(H,27,28)(H,23,25,29)/b15-11+/t13-/m1/s1 |
| InChIKey | CPBJEOOQFMYMGO-WDGDVPDHSA-N |
| XLogP | 2.52 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|