C26H21Cl2N3O5 — CID 5193286
ethyl 3-[3-[[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 5193286) has the molecular formula C26H21Cl2N3O5 and a molecular weight of 526.38 g/mol. Its IUPAC name is ethyl 3-[3-[[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | ethyl 3-[3-[[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 5193286 |
| Molecular Formula | C26H21Cl2N3O5 |
| Molecular Weight | 526.38 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | ethyl 3-[3-[[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-n2c(C)cc(C=C3C(=O)NC(=O)N(c4ccc(Cl)cc4Cl)C3=O)c2C)c1 |
| InChI | InChI=1S/C26H21Cl2N3O5/c1-4-36-25(34)16-6-5-7-19(11-16)30-14(2)10-17(15(30)3)12-20-23(32)29-26(35)31(24(20)33)22-9-8-18(27)13-21(22)28/h5-13H,4H2,1-3H3,(H,29,32,35) |
| InChIKey | XTQGKNRSPPKAGB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.38 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|