C18H14ClIN2O4 — CID 126028731
5-chloro-N-[(E)-(5-iodo-2,3-dimethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 126028731) has the molecular formula C18H14ClIN2O4 and a molecular weight of 484.68 g/mol. Its IUPAC name is 5-chloro-N-[(E)-(5-iodo-2,3-dimethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[(E)-(5-iodo-2,3-dimethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126028731 |
| Molecular Formula | C18H14ClIN2O4 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 483.97 |
| IUPAC Name | 5-chloro-N-[(E)-(5-iodo-2,3-dimethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(I)cc(/C=N/NC(=O)c2cc3cc(Cl)ccc3o2)c1OC |
| InChI | InChI=1S/C18H14ClIN2O4/c1-24-15-8-13(20)6-11(17(15)25-2)9-21-22-18(23)16-7-10-5-12(19)3-4-14(10)26-16/h3-9H,1-2H3,(H,22,23)/b21-9+ |
| InChIKey | GOMQKPTYFGKKAS-ZVBGSRNCSA-N |
| XLogP | 4.47 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|