C27H29N3O5S — CID 126194326
ethyl 2-[3-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 126194326) has the molecular formula C27H29N3O5S and a molecular weight of 507.61 g/mol. Its IUPAC name is ethyl 2-[3-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 126194326 |
| Molecular Formula | C27H29N3O5S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | ethyl 2-[3-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-n2c(C)cc(/C=N/NC(=O)c3cc4cc(OCC)ccc4o3)c2C)sc(C)c1C |
| InChI | InChI=1S/C27H29N3O5S/c1-7-33-21-9-10-22-19(12-21)13-23(35-22)25(31)29-28-14-20-11-15(3)30(17(20)5)26-24(27(32)34-8-2)16(4)18(6)36-26/h9-14H,7-8H2,1-6H3,(H,29,31)/b28-14+ |
| InChIKey | WVNYKQINYZIPHX-CCVNUDIWSA-N |
| XLogP | 5.86 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|