C37H31N3O5 — CID 126194440
ethyl 4-[3-[(Z)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2,5-diphenylpyrrol-1-yl]benzoate (PubChem CID 126194440) has the molecular formula C37H31N3O5 and a molecular weight of 597.67 g/mol. Its IUPAC name is ethyl 4-[3-[(Z)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2,5-diphenylpyrrol-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[(Z)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2,5-diphenylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 126194440 |
| Molecular Formula | C37H31N3O5 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | ethyl 4-[3-[(Z)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2,5-diphenylpyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(-c3ccccc3)cc(/C=N\NC(=O)c3cc4cc(OCC)ccc4o3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C37H31N3O5/c1-3-43-31-19-20-33-28(21-31)23-34(45-33)36(41)39-38-24-29-22-32(25-11-7-5-8-12-25)40(35(29)26-13-9-6-10-14-26)30-17-15-27(16-18-30)37(42)44-4-2/h5-24H,3-4H2,1-2H3,(H,39,41)/b38-24- |
| InChIKey | XJMGYMBXZQELRZ-CKJBABAKSA-N |
| XLogP | 7.90 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|